Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 3543-73-5, Name is Ethyl 4-(5-amino-1-methyl-1H-benzo[d]imidazol-2-yl)butanoate, SMILES is O=C(OCC)CCCC1=NC2=CC(N)=CC=C2N1C, belongs to imidazoles-derivatives compound. In a document, author is Rajaguru, Kandasamy, introduce the new discover, Category: imidazoles-derivatives.
Erbium Triflate Promoted Multicomponent Synthesis of Highly Substituted Imidazoles
The synthesis of highly substituted imidazole derivatives has been achieved from various alpha-azido chalcones, aryl aldehydes, and anilines. This multicomponent protocol employs erbium triflate as a catalyst resulting in excellent yield of the imidazoles.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 3543-73-5 is helpful to your research. Category: imidazoles-derivatives.