Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, SDS of cas: 3543-72-4, 3543-72-4, Name is Ethyl 4-(1-methyl-5-nitro-1H-benzo[d]imidazol-2-yl)butanoate, SMILES is O=C(OCC)CCCC1=NC2=CC([N+]([O-])=O)=CC=C2N1C, belongs to imidazoles-derivatives compound. In a document, author is Gharib, A., introduce the new discover.
Synthesis of 2,4,5-trisubstituted and 1,2,4,5-tetrasubstituted-1H-imidazole derivatives and or 2,4,5-Triaryloxazoles using of Silica-Supported Preyssler Nanoparticles
One-pot multi-component condensation of benzil and or benzoin, aldehydes, ammonium acetate and primary amines were used for synthesis of 2,4,5-trisubstituted and 1,2,4,5-tetrasubstituted-1H-imidazole derivatives under reflux conditions using Silica-supported Preyssler nanoparticles heteropolyacid as a catalysts. This catalyst has several advantages (simple work-up, inexpensive and reusability). These catalysts were also successfully employed in the synthesis of triaryloxazoles.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 3543-72-4. SDS of cas: 3543-72-4.